C22H28N4O2 — CID 119865151
2-amino-N-[4-methyl-3-[(2-piperidin-1-ylacetyl)amino]phenyl]-2-phenylacetamide (PubChem CID 119865151) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-amino-N-[4-methyl-3-[(2-piperidin-1-ylacetyl)amino]phenyl]-2-phenylacetamide.
| Compound Name | 2-amino-N-[4-methyl-3-[(2-piperidin-1-ylacetyl)amino]phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 119865151 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2-amino-N-[4-methyl-3-[(2-piperidin-1-ylacetyl)amino]phenyl]-2-phenylacetamide |
| SMILES | Cc1ccc(NC(=O)C(N)c2ccccc2)cc1NC(=O)CN1CCCCC1 |
| InChI | InChI=1S/C22H28N4O2/c1-16-10-11-18(24-22(28)21(23)17-8-4-2-5-9-17)14-19(16)25-20(27)15-26-12-6-3-7-13-26/h2,4-5,8-11,14,21H,3,6-7,12-13,15,23H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | MOUYFMWBOSLASG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |