C20H19BrFN3O2S — CID 112844711
3-[(2-bromo-3,4-dimethoxyphenyl)methylsulfanyl]-5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazole (PubChem CID 112844711) has the molecular formula C20H19BrFN3O2S and a molecular weight of 464.36 g/mol. Its IUPAC name is 3-[(2-bromo-3,4-dimethoxyphenyl)methylsulfanyl]-5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[(2-bromo-3,4-dimethoxyphenyl)methylsulfanyl]-5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 112844711 |
| Molecular Formula | C20H19BrFN3O2S |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | 3-[(2-bromo-3,4-dimethoxyphenyl)methylsulfanyl]-5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2ccc(OC)c(OC)c2Br)nnc1-c1ccccc1F |
| InChI | InChI=1S/C20H19BrFN3O2S/c1-4-11-25-19(14-7-5-6-8-15(14)22)23-24-20(25)28-12-13-9-10-16(26-2)18(27-3)17(13)21/h4-10H,1,11-12H2,2-3H3 |
| InChIKey | CRMYHFDUZQQDIQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|