C19H26N4O — CID 112847480
6-(dipropylamino)-N,2-dimethyl-N-phenylpyrimidine-4-carboxamide (PubChem CID 112847480) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 6-(dipropylamino)-N,2-dimethyl-N-phenylpyrimidine-4-carboxamide.
| Compound Name | 6-(dipropylamino)-N,2-dimethyl-N-phenylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112847480 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 6-(dipropylamino)-N,2-dimethyl-N-phenylpyrimidine-4-carboxamide |
| SMILES | CCCN(CCC)c1cc(C(=O)N(C)c2ccccc2)nc(C)n1 |
| InChI | InChI=1S/C19H26N4O/c1-5-12-23(13-6-2)18-14-17(20-15(3)21-18)19(24)22(4)16-10-8-7-9-11-16/h7-11,14H,5-6,12-13H2,1-4H3 |
| InChIKey | XMFMRRZUKNRINJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |