C22H23N5O — CID 112848751
2,3-dihydroindol-1-yl-[6-[4-(dimethylamino)anilino]-2-methylpyrimidin-4-yl]methanone (PubChem CID 112848751) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-[6-[4-(dimethylamino)anilino]-2-methylpyrimidin-4-yl]methanone.
| Compound Name | 2,3-dihydroindol-1-yl-[6-[4-(dimethylamino)anilino]-2-methylpyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 112848751 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2,3-dihydroindol-1-yl-[6-[4-(dimethylamino)anilino]-2-methylpyrimidin-4-yl]methanone |
| SMILES | Cc1nc(Nc2ccc(N(C)C)cc2)cc(C(=O)N2CCc3ccccc32)n1 |
| InChI | InChI=1S/C22H23N5O/c1-15-23-19(22(28)27-13-12-16-6-4-5-7-20(16)27)14-21(24-15)25-17-8-10-18(11-9-17)26(2)3/h4-11,14H,12-13H2,1-3H3,(H,23,24,25) |
| InChIKey | NGMVCAXJXGIFFD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|