C21H20N4O3 — CID 112851331
N-(1,3-benzodioxol-5-yl)-2-phenyl-6-(propylamino)pyrimidine-4-carboxamide (PubChem CID 112851331) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-phenyl-6-(propylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-phenyl-6-(propylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112851331 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-phenyl-6-(propylamino)pyrimidine-4-carboxamide |
| SMILES | CCCNc1cc(C(=O)Nc2ccc3c(c2)OCO3)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H20N4O3/c1-2-10-22-19-12-16(24-20(25-19)14-6-4-3-5-7-14)21(26)23-15-8-9-17-18(11-15)28-13-27-17/h3-9,11-12H,2,10,13H2,1H3,(H,23,26)(H,22,24,25) |
| InChIKey | WCZRKYWQHHAOOD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |