C20H26N4O — CID 112851758
6-(cyclopropylamino)-2-phenyl-N,N-dipropylpyrimidine-4-carboxamide (PubChem CID 112851758) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is 6-(cyclopropylamino)-2-phenyl-N,N-dipropylpyrimidine-4-carboxamide.
| Compound Name | 6-(cyclopropylamino)-2-phenyl-N,N-dipropylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112851758 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 6-(cyclopropylamino)-2-phenyl-N,N-dipropylpyrimidine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(NC2CC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H26N4O/c1-3-12-24(13-4-2)20(25)17-14-18(21-16-10-11-16)23-19(22-17)15-8-6-5-7-9-15/h5-9,14,16H,3-4,10-13H2,1-2H3,(H,21,22,23) |
| InChIKey | ALKVPSGTVYSXIT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |