C20H15F3N4O — CID 112851824
6-(cyclopropylamino)-2-phenyl-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide (PubChem CID 112851824) has the molecular formula C20H15F3N4O and a molecular weight of 384.36 g/mol. Its IUPAC name is 6-(cyclopropylamino)-2-phenyl-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide.
| Compound Name | 6-(cyclopropylamino)-2-phenyl-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112851824 |
| Molecular Formula | C20H15F3N4O |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 6-(cyclopropylamino)-2-phenyl-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1cc(NC2CC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H15F3N4O/c21-13-8-9-14(18(23)17(13)22)26-20(28)15-10-16(24-12-6-7-12)27-19(25-15)11-4-2-1-3-5-11/h1-5,8-10,12H,6-7H2,(H,26,28)(H,24,25,27) |
| InChIKey | NVFBJNQVRDRNIA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|