C22H22N4O3 — CID 112851799
6-(cyclopropylamino)-N-(2,5-dimethoxyphenyl)-2-phenylpyrimidine-4-carboxamide (PubChem CID 112851799) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 6-(cyclopropylamino)-N-(2,5-dimethoxyphenyl)-2-phenylpyrimidine-4-carboxamide.
| Compound Name | 6-(cyclopropylamino)-N-(2,5-dimethoxyphenyl)-2-phenylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112851799 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 6-(cyclopropylamino)-N-(2,5-dimethoxyphenyl)-2-phenylpyrimidine-4-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2cc(NC3CC3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C22H22N4O3/c1-28-16-10-11-19(29-2)17(12-16)25-22(27)18-13-20(23-15-8-9-15)26-21(24-18)14-6-4-3-5-7-14/h3-7,10-13,15H,8-9H2,1-2H3,(H,25,27)(H,23,24,26) |
| InChIKey | HYTZXBWZCWQXBT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |