C16H19NO5S — CID 11285329
[(2R,3R)-1-(4-methylphenyl)sulfonyl-3-(prop-2-ynoxymethyl)aziridin-2-yl]methyl acetate (PubChem CID 11285329) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is [(2R,3R)-1-(4-methylphenyl)sulfonyl-3-(prop-2-ynoxymethyl)aziridin-2-yl]methyl acetate.
| Compound Name | [(2R,3R)-1-(4-methylphenyl)sulfonyl-3-(prop-2-ynoxymethyl)aziridin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11285329 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | [(2R,3R)-1-(4-methylphenyl)sulfonyl-3-(prop-2-ynoxymethyl)aziridin-2-yl]methyl acetate |
| SMILES | C#CCOC[C@H]1[C@H](COC(C)=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H19NO5S/c1-4-9-21-10-15-16(11-22-13(3)18)17(15)23(19,20)14-7-5-12(2)6-8-14/h1,5-8,15-16H,9-11H2,2-3H3/t15-,16-,17?/m0/s1 |
| InChIKey | DKYPXEHXPVRFHF-PYNWJHIZSA-N |
| XLogP | 0.95 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|