C27H37Br2N5O4S — CID 11285418
N-[[[(2R)-3-(4-amino-3,5-dibromophenyl)-1-oxo-1-(4-piperidin-1-ylpiperidin-1-yl)propan-2-yl]amino]methyl]-1-phenoxymethanesulfonamide (PubChem CID 11285418) has the molecular formula C27H37Br2N5O4S and a molecular weight of 687.50 g/mol. Its IUPAC name is N-[[[(2R)-3-(4-amino-3,5-dibromophenyl)-1-oxo-1-(4-piperidin-1-ylpiperidin-1-yl)propan-2-yl]amino]methyl]-1-phenoxymethanesulfonamide.
| Compound Name | N-[[[(2R)-3-(4-amino-3,5-dibromophenyl)-1-oxo-1-(4-piperidin-1-ylpiperidin-1-yl)propan-2-yl]amino]methyl]-1-phenoxymethanesulfonamide |
|---|---|
| PubChem CID | 11285418 |
| Molecular Formula | C27H37Br2N5O4S |
| Molecular Weight | 687.50 g/mol |
| Exact Mass | 685.09 |
| IUPAC Name | N-[[[(2R)-3-(4-amino-3,5-dibromophenyl)-1-oxo-1-(4-piperidin-1-ylpiperidin-1-yl)propan-2-yl]amino]methyl]-1-phenoxymethanesulfonamide |
| SMILES | Nc1c(Br)cc(C[C@@H](NCNS(=O)(=O)COc2ccccc2)C(=O)N2CCC(N3CCCCC3)CC2)cc1Br |
| InChI | InChI=1S/C27H37Br2N5O4S/c28-23-15-20(16-24(29)26(23)30)17-25(31-18-32-39(36,37)19-38-22-7-3-1-4-8-22)27(35)34-13-9-21(10-14-34)33-11-5-2-6-12-33/h1,3-4,7-8,15-16,21,25,31-32H,2,5-6,9-14,17-19,30H2/t25-/m1/s1 |
| InChIKey | ZPZFEUJVZWNTGN-RUZDIDTESA-N |
| XLogP | 3.68 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|