C19H28Br2N4O — CID 57270181
(2S)-2-amino-3-(4-amino-3,5-dibromophenyl)-1-(4-piperidin-1-ylpiperidin-1-yl)propan-1-one (PubChem CID 57270181) has the molecular formula C19H28Br2N4O and a molecular weight of 488.27 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-amino-3,5-dibromophenyl)-1-(4-piperidin-1-ylpiperidin-1-yl)propan-1-one.
| Compound Name | (2S)-2-amino-3-(4-amino-3,5-dibromophenyl)-1-(4-piperidin-1-ylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 57270181 |
| Molecular Formula | C19H28Br2N4O |
| Molecular Weight | 488.27 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | (2S)-2-amino-3-(4-amino-3,5-dibromophenyl)-1-(4-piperidin-1-ylpiperidin-1-yl)propan-1-one |
| SMILES | Nc1c(Br)cc(C[C@H](N)C(=O)N2CCC(N3CCCCC3)CC2)cc1Br |
| InChI | InChI=1S/C19H28Br2N4O/c20-15-10-13(11-16(21)18(15)23)12-17(22)19(26)25-8-4-14(5-9-25)24-6-2-1-3-7-24/h10-11,14,17H,1-9,12,22-23H2/t17-/m0/s1 |
| InChIKey | JZTYKHSPTFMCCV-KRWDZBQOSA-N |
| XLogP | 3.14 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|