C22H21N5O — CID 112854264
6-(2-cyanoanilino)-N,N-diethyl-2-phenylpyrimidine-4-carboxamide (PubChem CID 112854264) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is 6-(2-cyanoanilino)-N,N-diethyl-2-phenylpyrimidine-4-carboxamide.
| Compound Name | 6-(2-cyanoanilino)-N,N-diethyl-2-phenylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112854264 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 6-(2-cyanoanilino)-N,N-diethyl-2-phenylpyrimidine-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(Nc2ccccc2C#N)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H21N5O/c1-3-27(4-2)22(28)19-14-20(24-18-13-9-8-12-17(18)15-23)26-21(25-19)16-10-6-5-7-11-16/h5-14H,3-4H2,1-2H3,(H,24,25,26) |
| InChIKey | HYRLYMXRXYZQCJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |