C17H22N4O2 — CID 112855434
ethyl 2-[[6-(2-methylpropylamino)pyrimidin-4-yl]amino]benzoate (PubChem CID 112855434) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is ethyl 2-[[6-(2-methylpropylamino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[6-(2-methylpropylamino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 112855434 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | ethyl 2-[[6-(2-methylpropylamino)pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1cc(NCC(C)C)ncn1 |
| InChI | InChI=1S/C17H22N4O2/c1-4-23-17(22)13-7-5-6-8-14(13)21-16-9-15(19-11-20-16)18-10-12(2)3/h5-9,11-12H,4,10H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | ZUNMUSLIBHSTAD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |