C18H24N4O2 — CID 112908837
ethyl 2-[[6-methyl-2-(2-methylpropylamino)pyrimidin-4-yl]amino]benzoate (PubChem CID 112908837) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is ethyl 2-[[6-methyl-2-(2-methylpropylamino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[6-methyl-2-(2-methylpropylamino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 112908837 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | ethyl 2-[[6-methyl-2-(2-methylpropylamino)pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1cc(C)nc(NCC(C)C)n1 |
| InChI | InChI=1S/C18H24N4O2/c1-5-24-17(23)14-8-6-7-9-15(14)21-16-10-13(4)20-18(22-16)19-11-12(2)3/h6-10,12H,5,11H2,1-4H3,(H2,19,20,21,22) |
| InChIKey | NQPXFKSRJWIEIB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |