C17H24N4O — CID 112856745
4-N-(2,6-diethylphenyl)-6-N-(2-methoxyethyl)pyrimidine-4,6-diamine (PubChem CID 112856745) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 4-N-(2,6-diethylphenyl)-6-N-(2-methoxyethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,6-diethylphenyl)-6-N-(2-methoxyethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112856745 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 4-N-(2,6-diethylphenyl)-6-N-(2-methoxyethyl)pyrimidine-4,6-diamine |
| SMILES | CCc1cccc(CC)c1Nc1cc(NCCOC)ncn1 |
| InChI | InChI=1S/C17H24N4O/c1-4-13-7-6-8-14(5-2)17(13)21-16-11-15(19-12-20-16)18-9-10-22-3/h6-8,11-12H,4-5,9-10H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | RTKFBDJNLNOBBN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|