C18H26N4O — CID 112856928
6-N-(3-methoxypropyl)-4-N-(2-methyl-6-propan-2-ylphenyl)pyrimidine-4,6-diamine (PubChem CID 112856928) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 6-N-(3-methoxypropyl)-4-N-(2-methyl-6-propan-2-ylphenyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-(3-methoxypropyl)-4-N-(2-methyl-6-propan-2-ylphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112856928 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 6-N-(3-methoxypropyl)-4-N-(2-methyl-6-propan-2-ylphenyl)pyrimidine-4,6-diamine |
| SMILES | COCCCNc1cc(Nc2c(C)cccc2C(C)C)ncn1 |
| InChI | InChI=1S/C18H26N4O/c1-13(2)15-8-5-7-14(3)18(15)22-17-11-16(20-12-21-17)19-9-6-10-23-4/h5,7-8,11-13H,6,9-10H2,1-4H3,(H2,19,20,21,22) |
| InChIKey | LJVKHKBGFODSEU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|