C13H14ClFN4O — CID 112856757
4-N-(3-chloro-4-fluorophenyl)-6-N-(2-methoxyethyl)pyrimidine-4,6-diamine (PubChem CID 112856757) has the molecular formula C13H14ClFN4O and a molecular weight of 296.73 g/mol. Its IUPAC name is 4-N-(3-chloro-4-fluorophenyl)-6-N-(2-methoxyethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-chloro-4-fluorophenyl)-6-N-(2-methoxyethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112856757 |
| Molecular Formula | C13H14ClFN4O |
| Molecular Weight | 296.73 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 4-N-(3-chloro-4-fluorophenyl)-6-N-(2-methoxyethyl)pyrimidine-4,6-diamine |
| SMILES | COCCNc1cc(Nc2ccc(F)c(Cl)c2)ncn1 |
| InChI | InChI=1S/C13H14ClFN4O/c1-20-5-4-16-12-7-13(18-8-17-12)19-9-2-3-11(15)10(14)6-9/h2-3,6-8H,4-5H2,1H3,(H2,16,17,18,19) |
| InChIKey | IEAYJXOFTAIOQO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.73 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|