C18H26N4 — CID 112863482
6-N-(2-tert-butylphenyl)-4-N,4-N-diethylpyrimidine-4,6-diamine (PubChem CID 112863482) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is 6-N-(2-tert-butylphenyl)-4-N,4-N-diethylpyrimidine-4,6-diamine.
| Compound Name | 6-N-(2-tert-butylphenyl)-4-N,4-N-diethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112863482 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 6-N-(2-tert-butylphenyl)-4-N,4-N-diethylpyrimidine-4,6-diamine |
| SMILES | CCN(CC)c1cc(Nc2ccccc2C(C)(C)C)ncn1 |
| InChI | InChI=1S/C18H26N4/c1-6-22(7-2)17-12-16(19-13-20-17)21-15-11-9-8-10-14(15)18(3,4)5/h8-13H,6-7H2,1-5H3,(H,19,20,21) |
| InChIKey | UAHOAZMHHHSCFJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |