C7H4ClNO2 — CID 11286706
7-chloro-1,2-benzoxazol-3-one (PubChem CID 11286706) has the molecular formula C7H4ClNO2 and a molecular weight of 169.57 g/mol. Its IUPAC name is 7-chloro-1,2-benzoxazol-3-one.
| Compound Name | 7-chloro-1,2-benzoxazol-3-one |
|---|---|
| PubChem CID | 11286706 |
| Molecular Formula | C7H4ClNO2 |
| Molecular Weight | 169.57 g/mol |
| Exact Mass | 168.99 |
| IUPAC Name | 7-chloro-1,2-benzoxazol-3-one |
| SMILES | O=c1[nH]oc2c(Cl)cccc12 |
| InChI | InChI=1S/C7H4ClNO2/c8-5-3-1-2-4-6(5)11-9-7(4)10/h1-3H,(H,9,10) |
| InChIKey | PSJBNRGIWUPYOT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.57 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |