C12H20N4 — CID 112867710
4-N-tert-butyl-2-methyl-6-N-prop-2-enylpyrimidine-4,6-diamine (PubChem CID 112867710) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-N-tert-butyl-2-methyl-6-N-prop-2-enylpyrimidine-4,6-diamine.
| Compound Name | 4-N-tert-butyl-2-methyl-6-N-prop-2-enylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112867710 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 4-N-tert-butyl-2-methyl-6-N-prop-2-enylpyrimidine-4,6-diamine |
| SMILES | C=CCNc1cc(NC(C)(C)C)nc(C)n1 |
| InChI | InChI=1S/C12H20N4/c1-6-7-13-10-8-11(15-9(2)14-10)16-12(3,4)5/h6,8H,1,7H2,2-5H3,(H2,13,14,15,16) |
| InChIKey | YQRVEMRLGRTOPY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|