C10H20O2S — CID 11287192
(2R,4R)-2-tert-butyl-5,5-dimethyl-1,4-oxathiane 4-oxide (PubChem CID 11287192) has the molecular formula C10H20O2S and a molecular weight of 204.33 g/mol. Its IUPAC name is (2R,4R)-2-tert-butyl-5,5-dimethyl-1,4-oxathiane 4-oxide.
| Compound Name | (2R,4R)-2-tert-butyl-5,5-dimethyl-1,4-oxathiane 4-oxide |
|---|---|
| PubChem CID | 11287192 |
| Molecular Formula | C10H20O2S |
| Molecular Weight | 204.33 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (2R,4R)-2-tert-butyl-5,5-dimethyl-1,4-oxathiane 4-oxide |
| SMILES | CC(C)(C)[C@@H]1C[S@@](=O)C(C)(C)CO1 |
| InChI | InChI=1S/C10H20O2S/c1-9(2,3)8-6-13(11)10(4,5)7-12-8/h8H,6-7H2,1-5H3/t8-,13+/m0/s1 |
| InChIKey | UTMFAQVHSNLLIT-ISVAXAHUSA-N |
| XLogP | 1.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |