C22H26N6O — CID 112873258
6-[4-(4-methoxyphenyl)piperazin-1-yl]-2-methyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine (PubChem CID 112873258) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is 6-[4-(4-methoxyphenyl)piperazin-1-yl]-2-methyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-[4-(4-methoxyphenyl)piperazin-1-yl]-2-methyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112873258 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 6-[4-(4-methoxyphenyl)piperazin-1-yl]-2-methyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine |
| SMILES | COc1ccc(N2CCN(c3cc(NCc4ccccn4)nc(C)n3)CC2)cc1 |
| InChI | InChI=1S/C22H26N6O/c1-17-25-21(24-16-18-5-3-4-10-23-18)15-22(26-17)28-13-11-27(12-14-28)19-6-8-20(29-2)9-7-19/h3-10,15H,11-14,16H2,1-2H3,(H,24,25,26) |
| InChIKey | MJSYJXAOLAOEOE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|