C22H32N4 — CID 112876342
6-(4-benzylpiperidin-1-yl)-N-butyl-N,2-dimethylpyrimidin-4-amine (PubChem CID 112876342) has the molecular formula C22H32N4 and a molecular weight of 352.53 g/mol. Its IUPAC name is 6-(4-benzylpiperidin-1-yl)-N-butyl-N,2-dimethylpyrimidin-4-amine.
| Compound Name | 6-(4-benzylpiperidin-1-yl)-N-butyl-N,2-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112876342 |
| Molecular Formula | C22H32N4 |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | 6-(4-benzylpiperidin-1-yl)-N-butyl-N,2-dimethylpyrimidin-4-amine |
| SMILES | CCCCN(C)c1cc(N2CCC(Cc3ccccc3)CC2)nc(C)n1 |
| InChI | InChI=1S/C22H32N4/c1-4-5-13-25(3)21-17-22(24-18(2)23-21)26-14-11-20(12-15-26)16-19-9-7-6-8-10-19/h6-10,17,20H,4-5,11-16H2,1-3H3 |
| InChIKey | GUKANCFELSGWGL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |