C19H23ClN4O2 — CID 112876594
methyl 4-chloro-3-[[2-methyl-6-(3-methylpiperidin-1-yl)pyrimidin-4-yl]amino]benzoate (PubChem CID 112876594) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-methyl-6-(3-methylpiperidin-1-yl)pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-methyl-6-(3-methylpiperidin-1-yl)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 112876594 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | methyl 4-chloro-3-[[2-methyl-6-(3-methylpiperidin-1-yl)pyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(Nc2cc(N3CCCC(C)C3)nc(C)n2)c1 |
| InChI | InChI=1S/C19H23ClN4O2/c1-12-5-4-8-24(11-12)18-10-17(21-13(2)22-18)23-16-9-14(19(25)26-3)6-7-15(16)20/h6-7,9-10,12H,4-5,8,11H2,1-3H3,(H,21,22,23) |
| InChIKey | AYLWHESBQKZCFX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |