C17H20F2N4 — CID 112876851
6-(azepan-1-yl)-N-(2,6-difluorophenyl)-2-methylpyrimidin-4-amine (PubChem CID 112876851) has the molecular formula C17H20F2N4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 6-(azepan-1-yl)-N-(2,6-difluorophenyl)-2-methylpyrimidin-4-amine.
| Compound Name | 6-(azepan-1-yl)-N-(2,6-difluorophenyl)-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112876851 |
| Molecular Formula | C17H20F2N4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 6-(azepan-1-yl)-N-(2,6-difluorophenyl)-2-methylpyrimidin-4-amine |
| SMILES | Cc1nc(Nc2c(F)cccc2F)cc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C17H20F2N4/c1-12-20-15(22-17-13(18)7-6-8-14(17)19)11-16(21-12)23-9-4-2-3-5-10-23/h6-8,11H,2-5,9-10H2,1H3,(H,20,21,22) |
| InChIKey | GQMLXDUZPYBCQG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |