C23H26N4O2 — CID 112880134
N-(2,5-dimethoxyphenyl)-2-phenyl-6-piperidin-1-ylpyrimidin-4-amine (PubChem CID 112880134) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-phenyl-6-piperidin-1-ylpyrimidin-4-amine.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-phenyl-6-piperidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112880134 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-phenyl-6-piperidin-1-ylpyrimidin-4-amine |
| SMILES | COc1ccc(OC)c(Nc2cc(N3CCCCC3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C23H26N4O2/c1-28-18-11-12-20(29-2)19(15-18)24-21-16-22(27-13-7-4-8-14-27)26-23(25-21)17-9-5-3-6-10-17/h3,5-6,9-12,15-16H,4,7-8,13-14H2,1-2H3,(H,24,25,26) |
| InChIKey | QSDVHFDTFXTRAL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |