C23H28N4O2 — CID 112881558
4-N,4-N-diethyl-6-N-[2-(4-methoxyphenoxy)ethyl]-2-phenylpyrimidine-4,6-diamine (PubChem CID 112881558) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 4-N,4-N-diethyl-6-N-[2-(4-methoxyphenoxy)ethyl]-2-phenylpyrimidine-4,6-diamine.
| Compound Name | 4-N,4-N-diethyl-6-N-[2-(4-methoxyphenoxy)ethyl]-2-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112881558 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 4-N,4-N-diethyl-6-N-[2-(4-methoxyphenoxy)ethyl]-2-phenylpyrimidine-4,6-diamine |
| SMILES | CCN(CC)c1cc(NCCOc2ccc(OC)cc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H28N4O2/c1-4-27(5-2)22-17-21(25-23(26-22)18-9-7-6-8-10-18)24-15-16-29-20-13-11-19(28-3)12-14-20/h6-14,17H,4-5,15-16H2,1-3H3,(H,24,25,26) |
| InChIKey | UOPCHRMQVUXUIN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|