C16H20N4 — CID 112882242
2-N-benzyl-4-N-cyclopropyl-2-N-ethylpyrimidine-2,4-diamine (PubChem CID 112882242) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-N-benzyl-4-N-cyclopropyl-2-N-ethylpyrimidine-2,4-diamine.
| Compound Name | 2-N-benzyl-4-N-cyclopropyl-2-N-ethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112882242 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 2-N-benzyl-4-N-cyclopropyl-2-N-ethylpyrimidine-2,4-diamine |
| SMILES | CCN(Cc1ccccc1)c1nccc(NC2CC2)n1 |
| InChI | InChI=1S/C16H20N4/c1-2-20(12-13-6-4-3-5-7-13)16-17-11-10-15(19-16)18-14-8-9-14/h3-7,10-11,14H,2,8-9,12H2,1H3,(H,17,18,19) |
| InChIKey | BNNNMHNYBBBLBO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |