C22H24N4 — CID 112932954
2-N-benzyl-4-N-cyclopropyl-2-N-ethyl-6-phenylpyrimidine-2,4-diamine (PubChem CID 112932954) has the molecular formula C22H24N4 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-N-benzyl-4-N-cyclopropyl-2-N-ethyl-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-benzyl-4-N-cyclopropyl-2-N-ethyl-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112932954 |
| Molecular Formula | C22H24N4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 2-N-benzyl-4-N-cyclopropyl-2-N-ethyl-6-phenylpyrimidine-2,4-diamine |
| SMILES | CCN(Cc1ccccc1)c1nc(NC2CC2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H24N4/c1-2-26(16-17-9-5-3-6-10-17)22-24-20(18-11-7-4-8-12-18)15-21(25-22)23-19-13-14-19/h3-12,15,19H,2,13-14,16H2,1H3,(H,23,24,25) |
| InChIKey | YIRSKOBNKKAXPM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |