C16H31NO — CID 11288253
2-[(3R,4R)-3-ethenyl-1-heptylpiperidin-4-yl]ethanol (PubChem CID 11288253) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is 2-[(3R,4R)-3-ethenyl-1-heptylpiperidin-4-yl]ethanol.
| Compound Name | 2-[(3R,4R)-3-ethenyl-1-heptylpiperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 11288253 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 2-[(3R,4R)-3-ethenyl-1-heptylpiperidin-4-yl]ethanol |
| SMILES | C=C[C@H]1CN(CCCCCCC)CC[C@@H]1CCO |
| InChI | InChI=1S/C16H31NO/c1-3-5-6-7-8-11-17-12-9-16(10-13-18)15(4-2)14-17/h4,15-16,18H,2-3,5-14H2,1H3/t15-,16+/m0/s1 |
| InChIKey | NVYJDNRWHWNUCO-JKSUJKDBSA-N |
| XLogP | 3.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|