C11H21NO — CID 134859970
1-methyl-3-pent-4-enylpiperidin-2-ol (PubChem CID 134859970) has the molecular formula C11H21NO and a molecular weight of 183.30 g/mol. Its IUPAC name is 1-methyl-3-pent-4-enylpiperidin-2-ol.
| Compound Name | 1-methyl-3-pent-4-enylpiperidin-2-ol |
|---|---|
| PubChem CID | 134859970 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 1-methyl-3-pent-4-enylpiperidin-2-ol |
| SMILES | C=CCCCC1CCCN(C)C1O |
| InChI | InChI=1S/C11H21NO/c1-3-4-5-7-10-8-6-9-12(2)11(10)13/h3,10-11,13H,1,4-9H2,2H3 |
| InChIKey | WPMQSDRHZNSWTP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|