C13H25AcNO2 — CID 20696731
actinium;3-[(E)-1-methoxyhex-4-enyl]-1-methylpiperidin-4-ol (PubChem CID 20696731) has the molecular formula C13H25AcNO2 and a molecular weight of 454.35 g/mol. Its IUPAC name is actinium;3-[(E)-1-methoxyhex-4-enyl]-1-methylpiperidin-4-ol.
| Compound Name | actinium;3-[(E)-1-methoxyhex-4-enyl]-1-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 20696731 |
| Molecular Formula | C13H25AcNO2 |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | actinium;3-[(E)-1-methoxyhex-4-enyl]-1-methylpiperidin-4-ol |
| SMILES | C/C=C/CCC(OC)C1CN(C)CCC1O.[Ac] |
| InChI | InChI=1S/C13H25NO2.Ac/c1-4-5-6-7-13(16-3)11-10-14(2)9-8-12(11)15;/h4-5,11-13,15H,6-10H2,1-3H3;/b5-4+; |
| InChIKey | RFJXRTFDHKIBAJ-FXRZFVDSSA-N |
| XLogP | 1.67 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|