C11H20Ac2INO2 — CID 59971184
actinium;3-[(E)-1-hydroxy-5-(123I)iodopent-4-enyl]-1-methylpiperidin-4-ol (PubChem CID 59971184) has the molecular formula C11H20Ac2INO2 and a molecular weight of 775.19 g/mol. Its IUPAC name is actinium;3-[(E)-1-hydroxy-5-(123I)iodopent-4-enyl]-1-methylpiperidin-4-ol.
| Compound Name | actinium;3-[(E)-1-hydroxy-5-(123I)iodopent-4-enyl]-1-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 59971184 |
| Molecular Formula | C11H20Ac2INO2 |
| Molecular Weight | 775.19 g/mol |
| Exact Mass | 775.11 |
| IUPAC Name | actinium;3-[(E)-1-hydroxy-5-(123I)iodopent-4-enyl]-1-methylpiperidin-4-ol |
| SMILES | CN1CCC(O)C(C(O)CC/C=C/[123I])C1.[Ac].[Ac] |
| InChI | InChI=1S/C11H20INO2.2Ac/c1-13-7-5-11(15)9(8-13)10(14)4-2-3-6-12;;/h3,6,9-11,14-15H,2,4-5,7-8H2,1H3;;/b6-3+;;/i12-4;; |
| InChIKey | CHCJTTMXBNRWQW-CHVUFBJBSA-N |
| XLogP | 1.39 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|