C16H23N5O2S — CID 112883036
4-[2-[[2-(butylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide (PubChem CID 112883036) has the molecular formula C16H23N5O2S and a molecular weight of 349.46 g/mol. Its IUPAC name is 4-[2-[[2-(butylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[2-(butylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112883036 |
| Molecular Formula | C16H23N5O2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 4-[2-[[2-(butylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
| SMILES | CCCCNc1nccc(NCCc2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C16H23N5O2S/c1-2-3-10-19-16-20-12-9-15(21-16)18-11-8-13-4-6-14(7-5-13)24(17,22)23/h4-7,9,12H,2-3,8,10-11H2,1H3,(H2,17,22,23)(H2,18,19,20,21) |
| InChIKey | YSDNKCFVHZPZDA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|