C14H16N6O2S — CID 157016797
4-[2-[(7-methylpurin-2-yl)amino]ethyl]benzenesulfonamide (PubChem CID 157016797) has the molecular formula C14H16N6O2S and a molecular weight of 332.39 g/mol. Its IUPAC name is 4-[2-[(7-methylpurin-2-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[(7-methylpurin-2-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 157016797 |
| Molecular Formula | C14H16N6O2S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 4-[2-[(7-methylpurin-2-yl)amino]ethyl]benzenesulfonamide |
| SMILES | Cn1cnc2nc(NCCc3ccc(S(N)(=O)=O)cc3)ncc21 |
| InChI | InChI=1S/C14H16N6O2S/c1-20-9-18-13-12(20)8-17-14(19-13)16-7-6-10-2-4-11(5-3-10)23(15,21)22/h2-5,8-9H,6-7H2,1H3,(H2,15,21,22)(H,16,17,19) |
| InChIKey | WBBPMZBWXDDGQH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |