C18H17N7 — CID 157016578
7-methyl-N-[2-(4-phenylpyrimidin-2-yl)ethyl]purin-2-amine (PubChem CID 157016578) has the molecular formula C18H17N7 and a molecular weight of 331.38 g/mol. Its IUPAC name is 7-methyl-N-[2-(4-phenylpyrimidin-2-yl)ethyl]purin-2-amine.
| Compound Name | 7-methyl-N-[2-(4-phenylpyrimidin-2-yl)ethyl]purin-2-amine |
|---|---|
| PubChem CID | 157016578 |
| Molecular Formula | C18H17N7 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 7-methyl-N-[2-(4-phenylpyrimidin-2-yl)ethyl]purin-2-amine |
| SMILES | Cn1cnc2nc(NCCc3nccc(-c4ccccc4)n3)ncc21 |
| InChI | InChI=1S/C18H17N7/c1-25-12-22-17-15(25)11-21-18(24-17)20-10-8-16-19-9-7-14(23-16)13-5-3-2-4-6-13/h2-7,9,11-12H,8,10H2,1H3,(H,20,21,24) |
| InChIKey | MTJQWKPOOBDEOS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |