C10H13N9 — CID 157019497
7-methyl-N-[3-(2H-tetrazol-5-yl)propyl]purin-2-amine (PubChem CID 157019497) has the molecular formula C10H13N9 and a molecular weight of 259.28 g/mol. Its IUPAC name is 7-methyl-N-[3-(2H-tetrazol-5-yl)propyl]purin-2-amine.
| Compound Name | 7-methyl-N-[3-(2H-tetrazol-5-yl)propyl]purin-2-amine |
|---|---|
| PubChem CID | 157019497 |
| Molecular Formula | C10H13N9 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 7-methyl-N-[3-(2H-tetrazol-5-yl)propyl]purin-2-amine |
| SMILES | Cn1cnc2nc(NCCCc3nn[nH]n3)ncc21 |
| InChI | InChI=1S/C10H13N9/c1-19-6-13-9-7(19)5-12-10(14-9)11-4-2-3-8-15-17-18-16-8/h5-6H,2-4H2,1H3,(H,11,12,14)(H,15,16,17,18) |
| InChIKey | QOPKDGOZFMNNQB-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|