C15H20N8 — CID 163310513
N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-7-methylpurin-2-amine (PubChem CID 163310513) has the molecular formula C15H20N8 and a molecular weight of 312.38 g/mol. Its IUPAC name is N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-7-methylpurin-2-amine.
| Compound Name | N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-7-methylpurin-2-amine |
|---|---|
| PubChem CID | 163310513 |
| Molecular Formula | C15H20N8 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-7-methylpurin-2-amine |
| SMILES | Cn1cnc2nc(NCc3nncn3C3CCCCC3)ncc21 |
| InChI | InChI=1S/C15H20N8/c1-22-9-18-14-12(22)7-16-15(20-14)17-8-13-21-19-10-23(13)11-5-3-2-4-6-11/h7,9-11H,2-6,8H2,1H3,(H,16,17,20) |
| InChIKey | ADFMDGJQVLKCGX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |