C25H40N8O — CID 143941920
7-methyl-N-[3-(1,3,4-oxadiazol-2-ylmethyl)pentyl]purin-2-amine;(5E)-3,7,7-trimethylocta-1,5-dien-4-amine (PubChem CID 143941920) has the molecular formula C25H40N8O and a molecular weight of 468.65 g/mol. Its IUPAC name is 7-methyl-N-[3-(1,3,4-oxadiazol-2-ylmethyl)pentyl]purin-2-amine;(5E)-3,7,7-trimethylocta-1,5-dien-4-amine.
| Compound Name | 7-methyl-N-[3-(1,3,4-oxadiazol-2-ylmethyl)pentyl]purin-2-amine;(5E)-3,7,7-trimethylocta-1,5-dien-4-amine |
|---|---|
| PubChem CID | 143941920 |
| Molecular Formula | C25H40N8O |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.33 |
| IUPAC Name | 7-methyl-N-[3-(1,3,4-oxadiazol-2-ylmethyl)pentyl]purin-2-amine;(5E)-3,7,7-trimethylocta-1,5-dien-4-amine |
| SMILES | C=CC(C)C(N)/C=C/C(C)(C)C.CCC(CCNc1ncc2c(ncn2C)n1)Cc1nnco1 |
| InChI | InChI=1S/C14H19N7O.C11H21N/c1-3-10(6-12-20-18-9-22-12)4-5-15-14-16-7-11-13(19-14)17-8-21(11)2;1-6-9(2)10(12)7-8-11(3,4)5/h7-10H,3-6H2,1-2H3,(H,15,16,19);6-10H,1,12H2,2-5H3/b;8-7+ |
| InChIKey | OWEASRVMXUUTMP-ILHSMLOTSA-N |
| XLogP | 4.56 |
| TPSA | 120.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|