C20H22N4O — CID 112883783
2-N-butan-2-yl-4-N-(2-phenoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 112883783) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-N-butan-2-yl-4-N-(2-phenoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-butan-2-yl-4-N-(2-phenoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112883783 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-N-butan-2-yl-4-N-(2-phenoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | CCC(C)Nc1nccc(Nc2ccccc2Oc2ccccc2)n1 |
| InChI | InChI=1S/C20H22N4O/c1-3-15(2)22-20-21-14-13-19(24-20)23-17-11-7-8-12-18(17)25-16-9-5-4-6-10-16/h4-15H,3H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | ZUEUBXVVWNPDLI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |