C17H22N4 — CID 112884450
N-(1-phenylethyl)-4-piperidin-1-ylpyrimidin-2-amine (PubChem CID 112884450) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is N-(1-phenylethyl)-4-piperidin-1-ylpyrimidin-2-amine.
| Compound Name | N-(1-phenylethyl)-4-piperidin-1-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112884450 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | N-(1-phenylethyl)-4-piperidin-1-ylpyrimidin-2-amine |
| SMILES | CC(Nc1nccc(N2CCCCC2)n1)c1ccccc1 |
| InChI | InChI=1S/C17H22N4/c1-14(15-8-4-2-5-9-15)19-17-18-11-10-16(20-17)21-12-6-3-7-13-21/h2,4-5,8-11,14H,3,6-7,12-13H2,1H3,(H,18,19,20) |
| InChIKey | FIBQAGARWBJHAE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |