C15H16N4O2 — CID 130284682
3-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]-1,3-oxazolidin-2-one (PubChem CID 130284682) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 3-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 130284682 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](Nc1nccc(N2CCOC2=O)n1)c1ccccc1 |
| InChI | InChI=1S/C15H16N4O2/c1-11(12-5-3-2-4-6-12)17-14-16-8-7-13(18-14)19-9-10-21-15(19)20/h2-8,11H,9-10H2,1H3,(H,16,17,18)/t11-/m0/s1 |
| InChIKey | VRCPPSXFONHTQP-NSHDSACASA-N |
| XLogP | 2.61 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |