C13H15BrN4O — CID 112885809
2-N-(2-bromophenyl)-4-N-(2-methoxyethyl)pyrimidine-2,4-diamine (PubChem CID 112885809) has the molecular formula C13H15BrN4O and a molecular weight of 323.19 g/mol. Its IUPAC name is 2-N-(2-bromophenyl)-4-N-(2-methoxyethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2-bromophenyl)-4-N-(2-methoxyethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112885809 |
| Molecular Formula | C13H15BrN4O |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2-N-(2-bromophenyl)-4-N-(2-methoxyethyl)pyrimidine-2,4-diamine |
| SMILES | COCCNc1ccnc(Nc2ccccc2Br)n1 |
| InChI | InChI=1S/C13H15BrN4O/c1-19-9-8-15-12-6-7-16-13(18-12)17-11-5-3-2-4-10(11)14/h2-7H,8-9H2,1H3,(H2,15,16,17,18) |
| InChIKey | UXOMOHXQKFGMGV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|