C15H19ClN4O — CID 112886096
2-N-(3-chloro-2-methylphenyl)-4-N-(3-methoxypropyl)pyrimidine-2,4-diamine (PubChem CID 112886096) has the molecular formula C15H19ClN4O and a molecular weight of 306.80 g/mol. Its IUPAC name is 2-N-(3-chloro-2-methylphenyl)-4-N-(3-methoxypropyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-chloro-2-methylphenyl)-4-N-(3-methoxypropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112886096 |
| Molecular Formula | C15H19ClN4O |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-N-(3-chloro-2-methylphenyl)-4-N-(3-methoxypropyl)pyrimidine-2,4-diamine |
| SMILES | COCCCNc1ccnc(Nc2cccc(Cl)c2C)n1 |
| InChI | InChI=1S/C15H19ClN4O/c1-11-12(16)5-3-6-13(11)19-15-18-9-7-14(20-15)17-8-4-10-21-2/h3,5-7,9H,4,8,10H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | LGKUQWQOYRCEBK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|