C17H18NP — CID 11288608
3-diphenylphosphanyl-N,N-dimethylprop-2-yn-1-amine (PubChem CID 11288608) has the molecular formula C17H18NP and a molecular weight of 267.31 g/mol. Its IUPAC name is 3-diphenylphosphanyl-N,N-dimethylprop-2-yn-1-amine.
| Compound Name | 3-diphenylphosphanyl-N,N-dimethylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 11288608 |
| Molecular Formula | C17H18NP |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 3-diphenylphosphanyl-N,N-dimethylprop-2-yn-1-amine |
| SMILES | CN(C)CC#CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H18NP/c1-18(2)14-9-15-19(16-10-5-3-6-11-16)17-12-7-4-8-13-17/h3-8,10-13H,14H2,1-2H3 |
| InChIKey | ASHKGGOHCOJYRR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|