C25H29N5 — CID 112890827
N-benzyl-N-methyl-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pyrimidin-4-amine (PubChem CID 112890827) has the molecular formula C25H29N5 and a molecular weight of 399.54 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pyrimidin-4-amine.
| Compound Name | N-benzyl-N-methyl-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 112890827 |
| Molecular Formula | C25H29N5 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | N-benzyl-N-methyl-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pyrimidin-4-amine |
| SMILES | CN(Cc1ccccc1)c1ccnc(N2CCN(C/C=C/c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C25H29N5/c1-28(21-23-11-6-3-7-12-23)24-14-15-26-25(27-24)30-19-17-29(18-20-30)16-8-13-22-9-4-2-5-10-22/h2-15H,16-21H2,1H3/b13-8+ |
| InChIKey | VDPRCQALECIKHD-MDWZMJQESA-N |
| XLogP | 3.95 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |