C15H24O5 — CID 11289108
4-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-2-ethoxy-3,4-dihydro-2H-pyran-5-carbaldehyde (PubChem CID 11289108) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is 4-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-2-ethoxy-3,4-dihydro-2H-pyran-5-carbaldehyde.
| Compound Name | 4-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-2-ethoxy-3,4-dihydro-2H-pyran-5-carbaldehyde |
|---|---|
| PubChem CID | 11289108 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 4-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-2-ethoxy-3,4-dihydro-2H-pyran-5-carbaldehyde |
| SMILES | CCOC1CC(CC2OCC(C)(C)CO2)C(C=O)=CO1 |
| InChI | InChI=1S/C15H24O5/c1-4-17-13-5-11(12(7-16)8-18-13)6-14-19-9-15(2,3)10-20-14/h7-8,11,13-14H,4-6,9-10H2,1-3H3 |
| InChIKey | AOZONWIYWJMFDV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|