C19H30O5 — CID 11209947
(2Z)-2-[[4-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-2-ethoxy-3,4-dihydro-2H-pyran-5-yl]methylidene]butanal (PubChem CID 11209947) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is (2Z)-2-[[4-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-2-ethoxy-3,4-dihydro-2H-pyran-5-yl]methylidene]butanal.
| Compound Name | (2Z)-2-[[4-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-2-ethoxy-3,4-dihydro-2H-pyran-5-yl]methylidene]butanal |
|---|---|
| PubChem CID | 11209947 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (2Z)-2-[[4-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-2-ethoxy-3,4-dihydro-2H-pyran-5-yl]methylidene]butanal |
| SMILES | CCOC1CC(CC2OCC(C)(C)CO2)C(/C=C(\C=O)CC)=CO1 |
| InChI | InChI=1S/C19H30O5/c1-5-14(10-20)7-16-11-22-17(21-6-2)8-15(16)9-18-23-12-19(3,4)13-24-18/h7,10-11,15,17-18H,5-6,8-9,12-13H2,1-4H3/b14-7- |
| InChIKey | YXXZAAULGJHVMF-AUWJEWJLSA-N |
| XLogP | 3.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|