C19H30O5 — CID 11484532
(Z)-3-[4-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-2-ethoxy-3-methyl-3,4-dihydro-2H-pyran-5-yl]-2-methylprop-2-enal (PubChem CID 11484532) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is (Z)-3-[4-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-2-ethoxy-3-methyl-3,4-dihydro-2H-pyran-5-yl]-2-methylprop-2-enal.
| Compound Name | (Z)-3-[4-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-2-ethoxy-3-methyl-3,4-dihydro-2H-pyran-5-yl]-2-methylprop-2-enal |
|---|---|
| PubChem CID | 11484532 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (Z)-3-[4-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-2-ethoxy-3-methyl-3,4-dihydro-2H-pyran-5-yl]-2-methylprop-2-enal |
| SMILES | CCOC1OC=C(/C=C(/C)C=O)C(CC2OCC(C)(C)CO2)C1C |
| InChI | InChI=1S/C19H30O5/c1-6-21-18-14(3)16(15(10-22-18)7-13(2)9-20)8-17-23-11-19(4,5)12-24-17/h7,9-10,14,16-18H,6,8,11-12H2,1-5H3/b13-7- |
| InChIKey | NSYLIQJQNHTHCH-QPEQYQDCSA-N |
| XLogP | 3.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|