C13H14ClF3N2 — CID 11289294
1,2-dimethyl-3-(4-methylphenyl)-5-(trifluoromethyl)pyrazol-2-ium chloride (PubChem CID 11289294) has the molecular formula C13H14ClF3N2 and a molecular weight of 290.72 g/mol. Its IUPAC name is 1,2-dimethyl-3-(4-methylphenyl)-5-(trifluoromethyl)pyrazol-2-ium chloride.
| Compound Name | 1,2-dimethyl-3-(4-methylphenyl)-5-(trifluoromethyl)pyrazol-2-ium chloride |
|---|---|
| PubChem CID | 11289294 |
| Molecular Formula | C13H14ClF3N2 |
| Molecular Weight | 290.72 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1,2-dimethyl-3-(4-methylphenyl)-5-(trifluoromethyl)pyrazol-2-ium chloride |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)n(C)[n+]2C)cc1.[Cl-] |
| InChI | InChI=1S/C13H14F3N2.ClH/c1-9-4-6-10(7-5-9)11-8-12(13(14,15)16)18(3)17(11)2;/h4-8H,1-3H3;1H/q+1;/p-1 |
| InChIKey | RDCYZHURYGDLGP-UHFFFAOYSA-M |
| XLogP | -0.15 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.72 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|